C9H7F2N3O2 — CID 155573746
methyl 3-(azidomethyl)-2,6-difluorobenzoate (PubChem CID 155573746) has the molecular formula C9H7F2N3O2 and a molecular weight of 227.17 g/mol. Its IUPAC name is methyl 3-(azidomethyl)-2,6-difluorobenzoate.
| Compound Name | methyl 3-(azidomethyl)-2,6-difluorobenzoate |
|---|---|
| PubChem CID | 155573746 |
| Molecular Formula | C9H7F2N3O2 |
| Molecular Weight | 227.17 g/mol |
| Exact Mass | 227.05 |
| IUPAC Name | methyl 3-(azidomethyl)-2,6-difluorobenzoate |
| SMILES | COC(=O)c1c(F)ccc(CN=[N+]=[N-])c1F |
| InChI | InChI=1S/C9H7F2N3O2/c1-16-9(15)7-6(10)3-2-5(8(7)11)4-13-14-12/h2-3H,4H2,1H3 |
| InChIKey | BDFXSJLYNSYSGM-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 75.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.17 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|