C10H9ClF2N2O2 — CID 169365406
methyl 3-[(1-amino-2-chloroethylidene)amino]-2,6-difluorobenzoate (PubChem CID 169365406) has the molecular formula C10H9ClF2N2O2 and a molecular weight of 262.64 g/mol. Its IUPAC name is methyl 3-[(1-amino-2-chloroethylidene)amino]-2,6-difluorobenzoate.
| Compound Name | methyl 3-[(1-amino-2-chloroethylidene)amino]-2,6-difluorobenzoate |
|---|---|
| PubChem CID | 169365406 |
| Molecular Formula | C10H9ClF2N2O2 |
| Molecular Weight | 262.64 g/mol |
| Exact Mass | 262.03 |
| IUPAC Name | methyl 3-[(1-amino-2-chloroethylidene)amino]-2,6-difluorobenzoate |
| SMILES | COC(=O)c1c(F)ccc(/N=C(/N)CCl)c1F |
| InChI | InChI=1S/C10H9ClF2N2O2/c1-17-10(16)8-5(12)2-3-6(9(8)13)15-7(14)4-11/h2-3H,4H2,1H3,(H2,14,15) |
| InChIKey | AKPCOYMUGYMJCD-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.64 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|