C12H13ClN2O4 — CID 169367570
methyl 6-[(1-amino-2-chloroethylidene)amino]-2,3-dihydro-1,4-benzodioxine-7-carboxylate (PubChem CID 169367570) has the molecular formula C12H13ClN2O4 and a molecular weight of 284.70 g/mol. Its IUPAC name is methyl 6-[(1-amino-2-chloroethylidene)amino]-2,3-dihydro-1,4-benzodioxine-7-carboxylate.
| Compound Name | methyl 6-[(1-amino-2-chloroethylidene)amino]-2,3-dihydro-1,4-benzodioxine-7-carboxylate |
|---|---|
| PubChem CID | 169367570 |
| Molecular Formula | C12H13ClN2O4 |
| Molecular Weight | 284.70 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | methyl 6-[(1-amino-2-chloroethylidene)amino]-2,3-dihydro-1,4-benzodioxine-7-carboxylate |
| SMILES | COC(=O)c1cc2c(cc1/N=C(/N)CCl)OCCO2 |
| InChI | InChI=1S/C12H13ClN2O4/c1-17-12(16)7-4-9-10(19-3-2-18-9)5-8(7)15-11(14)6-13/h4-5H,2-3,6H2,1H3,(H2,14,15) |
| InChIKey | RCCYBFATEDXCSE-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.70 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|