C18H18N2O4S — CID 8902849
methyl 4-[[N'-(2,3-dihydro-1,4-benzodioxin-6-yl)carbamimidoyl]sulfanylmethyl]benzoate (PubChem CID 8902849) has the molecular formula C18H18N2O4S and a molecular weight of 358.42 g/mol. Its IUPAC name is methyl 4-[[N'-(2,3-dihydro-1,4-benzodioxin-6-yl)carbamimidoyl]sulfanylmethyl]benzoate.
| Compound Name | methyl 4-[[N'-(2,3-dihydro-1,4-benzodioxin-6-yl)carbamimidoyl]sulfanylmethyl]benzoate |
|---|---|
| PubChem CID | 8902849 |
| Molecular Formula | C18H18N2O4S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | methyl 4-[[N'-(2,3-dihydro-1,4-benzodioxin-6-yl)carbamimidoyl]sulfanylmethyl]benzoate |
| SMILES | COC(=O)c1ccc(CS/C(N)=N/c2ccc3c(c2)OCCO3)cc1 |
| InChI | InChI=1S/C18H18N2O4S/c1-22-17(21)13-4-2-12(3-5-13)11-25-18(19)20-14-6-7-15-16(10-14)24-9-8-23-15/h2-7,10H,8-9,11H2,1H3,(H2,19,20) |
| InChIKey | XAETUWASNBVMLV-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|