C13H13N3O4S — CID 169362653
methyl 6-[[(cyanoamino)-methylsulfanylmethylidene]amino]-2,3-dihydro-1,4-benzodioxine-7-carboxylate (PubChem CID 169362653) has the molecular formula C13H13N3O4S and a molecular weight of 307.33 g/mol. Its IUPAC name is methyl 6-[[(cyanoamino)-methylsulfanylmethylidene]amino]-2,3-dihydro-1,4-benzodioxine-7-carboxylate.
| Compound Name | methyl 6-[[(cyanoamino)-methylsulfanylmethylidene]amino]-2,3-dihydro-1,4-benzodioxine-7-carboxylate |
|---|---|
| PubChem CID | 169362653 |
| Molecular Formula | C13H13N3O4S |
| Molecular Weight | 307.33 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | methyl 6-[[(cyanoamino)-methylsulfanylmethylidene]amino]-2,3-dihydro-1,4-benzodioxine-7-carboxylate |
| SMILES | COC(=O)c1cc2c(cc1/N=C(/NC#N)SC)OCCO2 |
| InChI | InChI=1S/C13H13N3O4S/c1-18-12(17)8-5-10-11(20-4-3-19-10)6-9(8)16-13(21-2)15-7-14/h5-6H,3-4H2,1-2H3,(H,15,16) |
| InChIKey | WIOYDKVMJXTWDK-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.33 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|