C12H11N3O3S — CID 169364510
methyl N'-(6-acetyl-1,3-benzodioxol-5-yl)-N-cyanocarbamimidothioate (PubChem CID 169364510) has the molecular formula C12H11N3O3S and a molecular weight of 277.31 g/mol. Its IUPAC name is methyl N'-(6-acetyl-1,3-benzodioxol-5-yl)-N-cyanocarbamimidothioate.
| Compound Name | methyl N'-(6-acetyl-1,3-benzodioxol-5-yl)-N-cyanocarbamimidothioate |
|---|---|
| PubChem CID | 169364510 |
| Molecular Formula | C12H11N3O3S |
| Molecular Weight | 277.31 g/mol |
| Exact Mass | 277.05 |
| IUPAC Name | methyl N'-(6-acetyl-1,3-benzodioxol-5-yl)-N-cyanocarbamimidothioate |
| SMILES | CS/C(=N\c1cc2c(cc1C(C)=O)OCO2)NC#N |
| InChI | InChI=1S/C12H11N3O3S/c1-7(16)8-3-10-11(18-6-17-10)4-9(8)15-12(19-2)14-5-13/h3-4H,6H2,1-2H3,(H,14,15) |
| InChIKey | BGXCGRNLGCREDG-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.31 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|