C12H11N3O3S — CID 3610212
[2-(1,3-benzodioxol-5-yl)-2-oxoethyl] N-cyano-N'-methylcarbamimidothioate (PubChem CID 3610212) has the molecular formula C12H11N3O3S and a molecular weight of 277.31 g/mol. Its IUPAC name is [2-(1,3-benzodioxol-5-yl)-2-oxoethyl] N-cyano-N'-methylcarbamimidothioate.
| Compound Name | [2-(1,3-benzodioxol-5-yl)-2-oxoethyl] N-cyano-N'-methylcarbamimidothioate |
|---|---|
| PubChem CID | 3610212 |
| Molecular Formula | C12H11N3O3S |
| Molecular Weight | 277.31 g/mol |
| Exact Mass | 277.05 |
| IUPAC Name | [2-(1,3-benzodioxol-5-yl)-2-oxoethyl] N-cyano-N'-methylcarbamimidothioate |
| SMILES | C/N=C(\NC#N)SCC(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C12H11N3O3S/c1-14-12(15-6-13)19-5-9(16)8-2-3-10-11(4-8)18-7-17-10/h2-4H,5,7H2,1H3,(H,14,15) |
| InChIKey | AJAOQAZTNYYSOJ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.31 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|