C16H14O3S — CID 47356559
1-(1,3-benzodioxol-5-yl)-2-(3-methylphenyl)sulfanylethanone (PubChem CID 47356559) has the molecular formula C16H14O3S and a molecular weight of 286.35 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-2-(3-methylphenyl)sulfanylethanone.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-2-(3-methylphenyl)sulfanylethanone |
|---|---|
| PubChem CID | 47356559 |
| Molecular Formula | C16H14O3S |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-2-(3-methylphenyl)sulfanylethanone |
| SMILES | Cc1cccc(SCC(=O)c2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C16H14O3S/c1-11-3-2-4-13(7-11)20-9-14(17)12-5-6-15-16(8-12)19-10-18-15/h2-8H,9-10H2,1H3 |
| InChIKey | IFGAIDAYXXOVCR-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |