C12H13N3O2S — CID 169360202
methyl 2-[[(cyanoamino)-methylsulfanylmethylidene]amino]-3-methylbenzoate (PubChem CID 169360202) has the molecular formula C12H13N3O2S and a molecular weight of 263.32 g/mol. Its IUPAC name is methyl 2-[[(cyanoamino)-methylsulfanylmethylidene]amino]-3-methylbenzoate.
| Compound Name | methyl 2-[[(cyanoamino)-methylsulfanylmethylidene]amino]-3-methylbenzoate |
|---|---|
| PubChem CID | 169360202 |
| Molecular Formula | C12H13N3O2S |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | methyl 2-[[(cyanoamino)-methylsulfanylmethylidene]amino]-3-methylbenzoate |
| SMILES | COC(=O)c1cccc(C)c1/N=C(/NC#N)SC |
| InChI | InChI=1S/C12H13N3O2S/c1-8-5-4-6-9(11(16)17-2)10(8)15-12(18-3)14-7-13/h4-6H,1-3H3,(H,14,15) |
| InChIKey | PMWCWEVQTITDOV-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 74.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|