C11H10N4O4S — CID 169362042
methyl 2-[[(cyanoamino)-methylsulfanylmethylidene]amino]-4-nitrobenzoate (PubChem CID 169362042) has the molecular formula C11H10N4O4S and a molecular weight of 294.29 g/mol. Its IUPAC name is methyl 2-[[(cyanoamino)-methylsulfanylmethylidene]amino]-4-nitrobenzoate.
| Compound Name | methyl 2-[[(cyanoamino)-methylsulfanylmethylidene]amino]-4-nitrobenzoate |
|---|---|
| PubChem CID | 169362042 |
| Molecular Formula | C11H10N4O4S |
| Molecular Weight | 294.29 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | methyl 2-[[(cyanoamino)-methylsulfanylmethylidene]amino]-4-nitrobenzoate |
| SMILES | COC(=O)c1ccc([N+](=O)[O-])cc1/N=C(/NC#N)SC |
| InChI | InChI=1S/C11H10N4O4S/c1-19-10(16)8-4-3-7(15(17)18)5-9(8)14-11(20-2)13-6-12/h3-5H,1-2H3,(H,13,14) |
| InChIKey | XQMPMDYWNDAQJQ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 117.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.29 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|