C11H13N5O3S — CID 169360409
methyl N-cyano-N'-[2-(2-hydroxyethylamino)-5-nitrophenyl]carbamimidothioate (PubChem CID 169360409) has the molecular formula C11H13N5O3S and a molecular weight of 295.32 g/mol. Its IUPAC name is methyl N-cyano-N'-[2-(2-hydroxyethylamino)-5-nitrophenyl]carbamimidothioate.
| Compound Name | methyl N-cyano-N'-[2-(2-hydroxyethylamino)-5-nitrophenyl]carbamimidothioate |
|---|---|
| PubChem CID | 169360409 |
| Molecular Formula | C11H13N5O3S |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | methyl N-cyano-N'-[2-(2-hydroxyethylamino)-5-nitrophenyl]carbamimidothioate |
| SMILES | CS/C(=N\c1cc([N+](=O)[O-])ccc1NCCO)NC#N |
| InChI | InChI=1S/C11H13N5O3S/c1-20-11(14-7-12)15-10-6-8(16(18)19)2-3-9(10)13-4-5-17/h2-3,6,13,17H,4-5H2,1H3,(H,14,15) |
| InChIKey | AEMJKYADGLKZCF-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 123.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|