C9H9BN4O4S — CID 169362828
[3-[[(cyanoamino)-methylsulfanylmethylidene]amino]-5-nitrophenyl]boronic acid (PubChem CID 169362828) has the molecular formula C9H9BN4O4S and a molecular weight of 280.07 g/mol. Its IUPAC name is [3-[[(cyanoamino)-methylsulfanylmethylidene]amino]-5-nitrophenyl]boronic acid.
| Compound Name | [3-[[(cyanoamino)-methylsulfanylmethylidene]amino]-5-nitrophenyl]boronic acid |
|---|---|
| PubChem CID | 169362828 |
| Molecular Formula | C9H9BN4O4S |
| Molecular Weight | 280.07 g/mol |
| Exact Mass | 280.04 |
| IUPAC Name | [3-[[(cyanoamino)-methylsulfanylmethylidene]amino]-5-nitrophenyl]boronic acid |
| SMILES | CS/C(=N\c1cc(B(O)O)cc([N+](=O)[O-])c1)NC#N |
| InChI | InChI=1S/C9H9BN4O4S/c1-19-9(12-5-11)13-7-2-6(10(15)16)3-8(4-7)14(17)18/h2-4,15-16H,1H3,(H,12,13) |
| InChIKey | XQLTUMOBVSYUGR-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 131.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.07 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|