C11H11BrN4O2S — CID 169363341
methyl N'-(6-bromo-2,3-dimethyl-4-nitrophenyl)-N-cyanocarbamimidothioate (PubChem CID 169363341) has the molecular formula C11H11BrN4O2S and a molecular weight of 343.21 g/mol. Its IUPAC name is methyl N'-(6-bromo-2,3-dimethyl-4-nitrophenyl)-N-cyanocarbamimidothioate.
| Compound Name | methyl N'-(6-bromo-2,3-dimethyl-4-nitrophenyl)-N-cyanocarbamimidothioate |
|---|---|
| PubChem CID | 169363341 |
| Molecular Formula | C11H11BrN4O2S |
| Molecular Weight | 343.21 g/mol |
| Exact Mass | 341.98 |
| IUPAC Name | methyl N'-(6-bromo-2,3-dimethyl-4-nitrophenyl)-N-cyanocarbamimidothioate |
| SMILES | CS/C(=N\c1c(Br)cc([N+](=O)[O-])c(C)c1C)NC#N |
| InChI | InChI=1S/C11H11BrN4O2S/c1-6-7(2)10(15-11(19-3)14-5-13)8(12)4-9(6)16(17)18/h4H,1-3H3,(H,14,15) |
| InChIKey | UYWVEZZMOFRBOZ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.21 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|