About methyl N'-(3-bromo-2,4,6-trimethylphenyl)-N-cyanocarbamimidothioate
methyl N'-(3-bromo-2,4,6-trimethylphenyl)-N-cyanocarbamimidothioate (PubChem CID 169360620) has the molecular formula C12H14BrN3S
and a molecular weight of 312.24 g/mol. Its IUPAC name is methyl N'-(3-bromo-2,4,6-trimethylphenyl)-N-cyanocarbamimidothioate.
Molecular Properties
| Compound Name | methyl N'-(3-bromo-2,4,6-trimethylphenyl)-N-cyanocarbamimidothioate |
| PubChem CID | 169360620 |
| Molecular Formula | C12H14BrN3S |
| Molecular Weight | 312.24 g/mol |
| Exact Mass | 311.01 |
| IUPAC Name | methyl N'-(3-bromo-2,4,6-trimethylphenyl)-N-cyanocarbamimidothioate |
| SMILES | CS/C(=N\c1c(C)cc(C)c(Br)c1C)NC#N |
| InChI | InChI=1S/C12H14BrN3S/c1-7-5-8(2)11(9(3)10(7)13)16-12(17-4)15-6-14/h5H,1-4H3,(H,15,16) |
| InChIKey | GJRKEWKPPICDNP-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 48.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.24 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze methyl N'-(3-bromo-2,4,6-trimethylphenyl)-N-cyanocarbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N'-(3-bromo-2,4,6-trimethylphenyl)-N-cyanocarbamimidothioate?
The IUPAC name of methyl N'-(3-bromo-2,4,6-trimethylphenyl)-N-cyanocarbamimidothioate (CID 169360620) is methyl N'-(3-bromo-2,4,6-trimethylphenyl)-N-cyanocarbamimidothioate.
What is the SMILES notation for methyl N'-(3-bromo-2,4,6-trimethylphenyl)-N-cyanocarbamimidothioate?
The canonical SMILES for methyl N'-(3-bromo-2,4,6-trimethylphenyl)-N-cyanocarbamimidothioate is CS/C(=N\c1c(C)cc(C)c(Br)c1C)NC#N.
What is the InChIKey of methyl N'-(3-bromo-2,4,6-trimethylphenyl)-N-cyanocarbamimidothioate?
The InChIKey is GJRKEWKPPICDNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14BrN3S/c1-7-5-8(2)11(9(3)10(7)13)16-12(17-4)15-6-14/h5H,1-4H3,(H,15,16).
What are the key properties of methyl N'-(3-bromo-2,4,6-trimethylphenyl)-N-cyanocarbamimidothioate?
methyl N'-(3-bromo-2,4,6-trimethylphenyl)-N-cyanocarbamimidothioate has a molecular weight of 312.24 g/mol, XLogP of 3.80, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N'-(3-bromo-2,4,6-trimethylphenyl)-N-cyanocarbamimidothioate is sourced from PubChem (CID 169360620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).