C9H8N4O3S — CID 169360136
methyl N-cyano-N'-(4-hydroxy-3-nitrophenyl)carbamimidothioate (PubChem CID 169360136) has the molecular formula C9H8N4O3S and a molecular weight of 252.25 g/mol. Its IUPAC name is methyl N-cyano-N'-(4-hydroxy-3-nitrophenyl)carbamimidothioate.
| Compound Name | methyl N-cyano-N'-(4-hydroxy-3-nitrophenyl)carbamimidothioate |
|---|---|
| PubChem CID | 169360136 |
| Molecular Formula | C9H8N4O3S |
| Molecular Weight | 252.25 g/mol |
| Exact Mass | 252.03 |
| IUPAC Name | methyl N-cyano-N'-(4-hydroxy-3-nitrophenyl)carbamimidothioate |
| SMILES | CS/C(=N\c1ccc(O)c([N+](=O)[O-])c1)NC#N |
| InChI | InChI=1S/C9H8N4O3S/c1-17-9(11-5-10)12-6-2-3-8(14)7(4-6)13(15)16/h2-4,14H,1H3,(H,11,12) |
| InChIKey | QSJBFYIKKFLKRR-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 111.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.25 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|