C16H19FN4O5S2 — CID 143348054
N'-[4-(4-fluorophenyl)-5-formyl-6-propan-2-ylpyrimidin-2-yl]-N'-methylmethanedisulfonamide (PubChem CID 143348054) has the molecular formula C16H19FN4O5S2 and a molecular weight of 430.48 g/mol. Its IUPAC name is N'-[4-(4-fluorophenyl)-5-formyl-6-propan-2-ylpyrimidin-2-yl]-N'-methylmethanedisulfonamide.
| Compound Name | N'-[4-(4-fluorophenyl)-5-formyl-6-propan-2-ylpyrimidin-2-yl]-N'-methylmethanedisulfonamide |
|---|---|
| PubChem CID | 143348054 |
| Molecular Formula | C16H19FN4O5S2 |
| Molecular Weight | 430.48 g/mol |
| Exact Mass | 430.08 |
| IUPAC Name | N'-[4-(4-fluorophenyl)-5-formyl-6-propan-2-ylpyrimidin-2-yl]-N'-methylmethanedisulfonamide |
| SMILES | CC(C)c1nc(N(C)S(=O)(=O)CS(N)(=O)=O)nc(-c2ccc(F)cc2)c1C=O |
| InChI | InChI=1S/C16H19FN4O5S2/c1-10(2)14-13(8-22)15(11-4-6-12(17)7-5-11)20-16(19-14)21(3)28(25,26)9-27(18,23)24/h4-8,10H,9H2,1-3H3,(H2,18,23,24) |
| InChIKey | VASNLQKZCKWULG-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 140.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.48 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|