C17H22FN3O — CID 143766010
ethane;4-(4-fluorophenyl)-2-(methylamino)-6-propan-2-ylpyrimidine-5-carbaldehyde (PubChem CID 143766010) has the molecular formula C17H22FN3O and a molecular weight of 303.38 g/mol. Its IUPAC name is ethane;4-(4-fluorophenyl)-2-(methylamino)-6-propan-2-ylpyrimidine-5-carbaldehyde.
| Compound Name | ethane;4-(4-fluorophenyl)-2-(methylamino)-6-propan-2-ylpyrimidine-5-carbaldehyde |
|---|---|
| PubChem CID | 143766010 |
| Molecular Formula | C17H22FN3O |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | ethane;4-(4-fluorophenyl)-2-(methylamino)-6-propan-2-ylpyrimidine-5-carbaldehyde |
| SMILES | CC.CNc1nc(-c2ccc(F)cc2)c(C=O)c(C(C)C)n1 |
| InChI | InChI=1S/C15H16FN3O.C2H6/c1-9(2)13-12(8-20)14(19-15(17-3)18-13)10-4-6-11(16)7-5-10;1-2/h4-9H,1-3H3,(H,17,18,19);1-2H3 |
| InChIKey | NQBLSOFCAIXOOA-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|