C24H33F2NO2 — CID 67483460
fluoro-(4-fluorophenyl)-[3-(hydroxymethyl)-5-pentyl-2,6-di(propan-2-yl)-4-pyridinyl]methanol (PubChem CID 67483460) has the molecular formula C24H33F2NO2 and a molecular weight of 405.53 g/mol. Its IUPAC name is fluoro-(4-fluorophenyl)-[3-(hydroxymethyl)-5-pentyl-2,6-di(propan-2-yl)-4-pyridinyl]methanol.
| Compound Name | fluoro-(4-fluorophenyl)-[3-(hydroxymethyl)-5-pentyl-2,6-di(propan-2-yl)-4-pyridinyl]methanol |
|---|---|
| PubChem CID | 67483460 |
| Molecular Formula | C24H33F2NO2 |
| Molecular Weight | 405.53 g/mol |
| Exact Mass | 405.25 |
| IUPAC Name | fluoro-(4-fluorophenyl)-[3-(hydroxymethyl)-5-pentyl-2,6-di(propan-2-yl)-4-pyridinyl]methanol |
| SMILES | CCCCCc1c(C(C)C)nc(C(C)C)c(CO)c1C(O)(F)c1ccc(F)cc1 |
| InChI | InChI=1S/C24H33F2NO2/c1-6-7-8-9-19-21(24(26,29)17-10-12-18(25)13-11-17)20(14-28)23(16(4)5)27-22(19)15(2)3/h10-13,15-16,28-29H,6-9,14H2,1-5H3 |
| InChIKey | BBAZJUFOKQFEEC-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.53 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|