C46H36N4O2Zn — CID 56652116
zinc 5-butyl-10,20-bis(3-methoxyphenyl)-15-(2-phenylethynyl)porphyrin-22,24-diide (PubChem CID 56652116) has the molecular formula C46H36N4O2Zn and a molecular weight of 742.21 g/mol. Its IUPAC name is zinc 5-butyl-10,20-bis(3-methoxyphenyl)-15-(2-phenylethynyl)porphyrin-22,24-diide.
| Compound Name | zinc 5-butyl-10,20-bis(3-methoxyphenyl)-15-(2-phenylethynyl)porphyrin-22,24-diide |
|---|---|
| PubChem CID | 56652116 |
| Molecular Formula | C46H36N4O2Zn |
| Molecular Weight | 742.21 g/mol |
| Exact Mass | 740.21 |
| IUPAC Name | zinc 5-butyl-10,20-bis(3-methoxyphenyl)-15-(2-phenylethynyl)porphyrin-22,24-diide |
| SMILES | CCCCc1c2nc(c(-c3cccc(OC)c3)c3ccc([n-]3)c(C#Cc3ccccc3)c3nc(c(-c4cccc(OC)c4)c4ccc1[n-]4)C=C3)C=C2.[Zn+2] |
| InChI | InChI=1S/C46H36N4O2.Zn/c1-4-5-17-35-37-20-24-41(47-37)45(31-13-9-15-33(28-31)51-2)43-26-22-39(49-43)36(19-18-30-11-7-6-8-12-30)40-23-27-44(50-40)46(42-25-21-38(35)48-42)32-14-10-16-34(29-32)52-3;/h6-16,20-29H,4-5,17H2,1-3H3;/q-2;+2/b37-35-,38-35-,39-36-,40-36-,45-41-,45-43-,46-42-,46-44-; |
| InChIKey | HGTSUIFCYUTVBM-QIRPZOLYSA-N |
| XLogP | 10.00 |
| TPSA | 72.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.21 |
| LogP ≤ 5 | 10.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|