C48H32N4Zn — CID 166512473
zinc 5-(4-methylphenyl)-10,20-diphenyl-15-(4-prop-1-ynylphenyl)porphyrin-22,24-diide (PubChem CID 166512473) has the molecular formula C48H32N4Zn and a molecular weight of 730.20 g/mol. Its IUPAC name is zinc 5-(4-methylphenyl)-10,20-diphenyl-15-(4-prop-1-ynylphenyl)porphyrin-22,24-diide.
| Compound Name | zinc 5-(4-methylphenyl)-10,20-diphenyl-15-(4-prop-1-ynylphenyl)porphyrin-22,24-diide |
|---|---|
| PubChem CID | 166512473 |
| Molecular Formula | C48H32N4Zn |
| Molecular Weight | 730.20 g/mol |
| Exact Mass | 728.19 |
| IUPAC Name | zinc 5-(4-methylphenyl)-10,20-diphenyl-15-(4-prop-1-ynylphenyl)porphyrin-22,24-diide |
| SMILES | CC#Cc1ccc(-c2c3nc(c(-c4ccccc4)c4ccc([n-]4)c(-c4ccc(C)cc4)c4nc(c(-c5ccccc5)c5ccc2[n-]5)C=C4)C=C3)cc1.[Zn+2] |
| InChI | InChI=1S/C48H32N4.Zn/c1-3-10-32-17-21-36(22-18-32)48-43-29-25-39(51-43)45(33-11-6-4-7-12-33)37-23-27-41(49-37)47(35-19-15-31(2)16-20-35)42-28-24-38(50-42)46(34-13-8-5-9-14-34)40-26-30-44(48)52-40;/h4-9,11-30H,1-2H3;/q-2;+2/b45-37-,45-39-,46-38-,46-40-,47-41-,47-42-,48-43-,48-44-; |
| InChIKey | CZIQDPNSSHOXFD-FFRAJVPUSA-N |
| XLogP | 11.26 |
| TPSA | 53.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.20 |
| LogP ≤ 5 | 11.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|