C50H39N7Zn — CID 10373171
zinc 5-nonyl-10,15,20-tris(2-pyridin-2-ylethynyl)porphyrin-23,24-diide (PubChem CID 10373171) has the molecular formula C50H39N7Zn and a molecular weight of 803.30 g/mol. Its IUPAC name is zinc 5-nonyl-10,15,20-tris(2-pyridin-2-ylethynyl)porphyrin-23,24-diide.
| Compound Name | zinc 5-nonyl-10,15,20-tris(2-pyridin-2-ylethynyl)porphyrin-23,24-diide |
|---|---|
| PubChem CID | 10373171 |
| Molecular Formula | C50H39N7Zn |
| Molecular Weight | 803.30 g/mol |
| Exact Mass | 801.26 |
| IUPAC Name | zinc 5-nonyl-10,15,20-tris(2-pyridin-2-ylethynyl)porphyrin-23,24-diide |
| SMILES | CCCCCCCCCc1c2nc(c(C#Cc3ccccn3)c3ccc([n-]3)c(C#Cc3ccccn3)c3ccc([n-]3)c(C#Cc3ccccn3)c3nc1C=C3)C=C2.[Zn+2] |
| InChI | InChI=1S/C50H39N7.Zn/c1-2-3-4-5-6-7-8-18-39-43-25-27-45(54-43)40(22-19-36-15-9-12-33-51-36)47-29-31-49(56-47)42(24-21-38-17-11-14-35-53-38)50-32-30-48(57-50)41(46-28-26-44(39)55-46)23-20-37-16-10-13-34-52-37;/h9-17,25-35H,2-8,18H2,1H3;/q-2;+2/b43-39-,44-39-,45-40-,46-41-,47-40-,48-41-,49-42-,50-42-; |
| InChIKey | HHZHSJWLTJDVCX-UWBGHGPKSA-N |
| XLogP | 9.59 |
| TPSA | 92.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 803.30 |
| LogP ≤ 5 | 9.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|