C29H27I3N4Zn — CID 58774140
zinc 5,10,15-triiodo-20-nonylporphyrin-22,24-diide (PubChem CID 58774140) has the molecular formula C29H27I3N4Zn and a molecular weight of 877.66 g/mol. Its IUPAC name is zinc 5,10,15-triiodo-20-nonylporphyrin-22,24-diide.
| Compound Name | zinc 5,10,15-triiodo-20-nonylporphyrin-22,24-diide |
|---|---|
| PubChem CID | 58774140 |
| Molecular Formula | C29H27I3N4Zn |
| Molecular Weight | 877.66 g/mol |
| Exact Mass | 875.87 |
| IUPAC Name | zinc 5,10,15-triiodo-20-nonylporphyrin-22,24-diide |
| SMILES | CCCCCCCCCc1c2nc(c(I)c3ccc([n-]3)c(I)c3nc(c(I)c4ccc1[n-]4)C=C3)C=C2.[Zn+2] |
| InChI | InChI=1S/C29H27I3N4.Zn/c1-2-3-4-5-6-7-8-9-18-19-10-12-21(33-19)27(30)23-14-16-25(35-23)29(32)26-17-15-24(36-26)28(31)22-13-11-20(18)34-22;/h10-17H,2-9H2,1H3;/q-2;+2/b19-18-,20-18-,27-21+,27-23+,28-22+,28-24+,29-25+,29-26+; |
| InChIKey | KMMZOVKGECPKTQ-ZIQFNHGQSA-N |
| XLogP | 9.02 |
| TPSA | 53.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 877.66 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|