C72H116N4Zn — CID 11159087
zinc 5,10,15,20-tetra(tridecan-7-yl)porphyrin-22,24-diide (PubChem CID 11159087) has the molecular formula C72H116N4Zn and a molecular weight of 1103.14 g/mol. Its IUPAC name is zinc 5,10,15,20-tetra(tridecan-7-yl)porphyrin-22,24-diide.
| Compound Name | zinc 5,10,15,20-tetra(tridecan-7-yl)porphyrin-22,24-diide |
|---|---|
| PubChem CID | 11159087 |
| Molecular Formula | C72H116N4Zn |
| Molecular Weight | 1103.14 g/mol |
| Exact Mass | 1100.85 |
| IUPAC Name | zinc 5,10,15,20-tetra(tridecan-7-yl)porphyrin-22,24-diide |
| SMILES | CCCCCCC(CCCCCC)c1c2nc(c(C(CCCCCC)CCCCCC)c3ccc([n-]3)c(C(CCCCCC)CCCCCC)c3nc(c(C(CCCCCC)CCCCCC)c4ccc1[n-]4)C=C3)C=C2.[Zn+2] |
| InChI | InChI=1S/C72H116N4.Zn/c1-9-17-25-33-41-57(42-34-26-18-10-2)69-61-49-51-63(73-61)70(58(43-35-27-19-11-3)44-36-28-20-12-4)65-53-55-67(75-65)72(60(47-39-31-23-15-7)48-40-32-24-16-8)68-56-54-66(76-68)71(64-52-50-62(69)74-64)59(45-37-29-21-13-5)46-38-30-22-14-6;/h49-60H,9-48H2,1-8H3;/q-2;+2/b69-61-,69-62-,70-63-,70-65-,71-64-,71-66-,72-67-,72-68-; |
| InChIKey | DTCJGOALRIRJNQ-YHWFFDSRSA-N |
| XLogP | 24.01 |
| TPSA | 53.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 77 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1103.14 |
| LogP ≤ 5 | 24.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|