C66H96N4OZn — CID 15975457
zinc [4-[10,15,20-tri(tridecan-7-yl)porphyrin-23,24-diid-5-yl]phenyl]methanol (PubChem CID 15975457) has the molecular formula C66H96N4OZn and a molecular weight of 1026.91 g/mol. Its IUPAC name is zinc [4-[10,15,20-tri(tridecan-7-yl)porphyrin-23,24-diid-5-yl]phenyl]methanol.
| Compound Name | zinc [4-[10,15,20-tri(tridecan-7-yl)porphyrin-23,24-diid-5-yl]phenyl]methanol |
|---|---|
| PubChem CID | 15975457 |
| Molecular Formula | C66H96N4OZn |
| Molecular Weight | 1026.91 g/mol |
| Exact Mass | 1024.69 |
| IUPAC Name | zinc [4-[10,15,20-tri(tridecan-7-yl)porphyrin-23,24-diid-5-yl]phenyl]methanol |
| SMILES | CCCCCCC(CCCCCC)c1c2nc(c(-c3ccc(CO)cc3)c3nc(c(C(CCCCCC)CCCCCC)c4ccc([n-]4)c(C(CCCCCC)CCCCCC)c4ccc1[n-]4)C=C3)C=C2.[Zn+2] |
| InChI | InChI=1S/C66H96N4O.Zn/c1-7-13-19-25-31-51(32-26-20-14-8-2)63-55-41-43-57(67-55)64(52(33-27-21-15-9-3)34-28-22-16-10-4)59-45-47-61(69-59)66(54-39-37-50(49-71)38-40-54)62-48-46-60(70-62)65(58-44-42-56(63)68-58)53(35-29-23-17-11-5)36-30-24-18-12-6;/h37-48,51-53,71H,7-36,49H2,1-6H3;/q-2;+2/b63-55-,63-56-,64-57-,64-59-,65-58-,65-60-,66-61-,66-62-; |
| InChIKey | VTCHXHWHQUDKBY-OJYREOQRSA-N |
| XLogP | 20.14 |
| TPSA | 74.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1026.91 |
| LogP ≤ 5 | 20.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|