C80H96N8O4Zn — CID 163437681
zinc N-(2-ethylhexyl)-4-[10,15,20-tris[4-(2-ethylhexylcarbamoyl)phenyl]porphyrin-22,24-diid-5-yl]benzamide (PubChem CID 163437681) has the molecular formula C80H96N8O4Zn and a molecular weight of 1299.09 g/mol. Its IUPAC name is zinc N-(2-ethylhexyl)-4-[10,15,20-tris[4-(2-ethylhexylcarbamoyl)phenyl]porphyrin-22,24-diid-5-yl]benzamide.
| Compound Name | zinc N-(2-ethylhexyl)-4-[10,15,20-tris[4-(2-ethylhexylcarbamoyl)phenyl]porphyrin-22,24-diid-5-yl]benzamide |
|---|---|
| PubChem CID | 163437681 |
| Molecular Formula | C80H96N8O4Zn |
| Molecular Weight | 1299.09 g/mol |
| Exact Mass | 1296.68 |
| IUPAC Name | zinc N-(2-ethylhexyl)-4-[10,15,20-tris[4-(2-ethylhexylcarbamoyl)phenyl]porphyrin-22,24-diid-5-yl]benzamide |
| SMILES | CCCCC(CC)CNC(=O)c1ccc(-c2c3nc(c(-c4ccc(C(=O)NCC(CC)CCCC)cc4)c4ccc([n-]4)c(-c4ccc(C(=O)NCC(CC)CCCC)cc4)c4nc(c(-c5ccc(C(=O)NCC(CC)CCCC)cc5)c5ccc2[n-]5)C=C4)C=C3)cc1.[Zn+2] |
| InChI | InChI=1S/C80H98N8O4.Zn/c1-9-17-21-53(13-5)49-81-77(89)61-33-25-57(26-34-61)73-65-41-43-67(85-65)74(58-27-35-62(36-28-58)78(90)82-50-54(14-6)22-18-10-2)69-45-47-71(87-69)76(60-31-39-64(40-32-60)80(92)84-52-56(16-8)24-20-12-4)72-48-46-70(88-72)75(68-44-42-66(73)86-68)59-29-37-63(38-30-59)79(91)83-51-55(15-7)23-19-11-3;/h25-48,53-56H,9-24,49-52H2,1-8H3,(H6,81,82,83,84,85,86,87,88,89,90,91,92);/q;+2/p-2/b73-65-,73-66-,74-67-,74-69-,75-68-,75-70-,76-71-,76-72-; |
| InChIKey | AVWGBAKAOOPUSF-LOJAHXFYSA-L |
| XLogP | 18.36 |
| TPSA | 170.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 93 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1299.09 |
| LogP ≤ 5 | 18.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|