C66H75N7O4Zn — CID 58261019
zinc 2-[4-[10-(4-decoxyphenyl)-15,20-bis[4-[2-(dimethylamino)ethoxy]phenyl]porphyrin-22,24-diid-5-yl]phenoxy]-N,N-dimethylethanamine (PubChem CID 58261019) has the molecular formula C66H75N7O4Zn and a molecular weight of 1095.76 g/mol. Its IUPAC name is zinc 2-[4-[10-(4-decoxyphenyl)-15,20-bis[4-[2-(dimethylamino)ethoxy]phenyl]porphyrin-22,24-diid-5-yl]phenoxy]-N,N-dimethylethanamine.
| Compound Name | zinc 2-[4-[10-(4-decoxyphenyl)-15,20-bis[4-[2-(dimethylamino)ethoxy]phenyl]porphyrin-22,24-diid-5-yl]phenoxy]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 58261019 |
| Molecular Formula | C66H75N7O4Zn |
| Molecular Weight | 1095.76 g/mol |
| Exact Mass | 1093.52 |
| IUPAC Name | zinc 2-[4-[10-(4-decoxyphenyl)-15,20-bis[4-[2-(dimethylamino)ethoxy]phenyl]porphyrin-22,24-diid-5-yl]phenoxy]-N,N-dimethylethanamine |
| SMILES | CCCCCCCCCCOc1ccc(-c2c3nc(c(-c4ccc(OCCN(C)C)cc4)c4ccc([n-]4)c(-c4ccc(OCCN(C)C)cc4)c4nc(c(-c5ccc(OCCN(C)C)cc5)c5ccc2[n-]5)C=C4)C=C3)cc1.[Zn+2] |
| InChI | InChI=1S/C66H75N7O4.Zn/c1-8-9-10-11-12-13-14-15-43-74-51-24-16-47(17-25-51)63-55-32-34-57(67-55)64(48-18-26-52(27-19-48)75-44-40-71(2)3)59-36-38-61(69-59)66(50-22-30-54(31-23-50)77-46-42-73(6)7)62-39-37-60(70-62)65(58-35-33-56(63)68-58)49-20-28-53(29-21-49)76-45-41-72(4)5;/h16-39H,8-15,40-46H2,1-7H3;/q-2;+2/b63-55-,63-56-,64-57-,64-59-,65-58-,65-60-,66-61-,66-62-; |
| InChIKey | SEZSAYAEJFSEPZ-OJYREOQRSA-N |
| XLogP | 13.92 |
| TPSA | 100.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1095.76 |
| LogP ≤ 5 | 13.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|