C65H95IN4 — CID 16742253
5-(4-iodophenyl)-10,15,20-tri(tridecan-7-yl)-21,22-dihydroporphyrin (PubChem CID 16742253) has the molecular formula C65H95IN4 and a molecular weight of 1060.40 g/mol. Its IUPAC name is 5-(4-iodophenyl)-10,15,20-tri(tridecan-7-yl)-21,22-dihydroporphyrin.
| Compound Name | 5-(4-iodophenyl)-10,15,20-tri(tridecan-7-yl)-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 16742253 |
| Molecular Formula | C65H95IN4 |
| Molecular Weight | 1060.40 g/mol |
| Exact Mass | 1059.66 |
| IUPAC Name | 5-(4-iodophenyl)-10,15,20-tri(tridecan-7-yl)-21,22-dihydroporphyrin |
| SMILES | CCCCCCC(CCCCCC)c1c2nc(c(C(CCCCCC)CCCCCC)c3ccc([nH]3)[13c](-c3ccc(I)cc3)c3ccc([nH]3)c(C(CCCCCC)CCCCCC)c3nc1C=C3)C=C2 |
| InChI | InChI=1S/C65H95IN4/c1-7-13-19-25-31-49(32-26-20-14-8-2)62-54-41-43-56(67-54)63(50(33-27-21-15-9-3)34-28-22-16-10-4)58-45-47-60(69-58)65(52-37-39-53(66)40-38-52)61-48-46-59(70-61)64(57-44-42-55(62)68-57)51(35-29-23-17-11-5)36-30-24-18-12-6/h37-51,69-70H,7-36H2,1-6H3/b62-54-,62-55-,63-56-,63-58-,64-57-,64-59-,65-60-,65-61-/i65+1 |
| InChIKey | XIGJDZJYVBMEBX-TXLFMWRKSA-N |
| XLogP | 22.00 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1060.40 |
| LogP ≤ 5 | 22.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|