C72H94N8+4 — CID 10191876
5,10,15,20-tetrakis(1-octylpyridin-1-ium-4-yl)-21,22-dihydroporphyrin (PubChem CID 10191876) has the molecular formula C72H94N8+4 and a molecular weight of 1071.60 g/mol. Its IUPAC name is 5,10,15,20-tetrakis(1-octylpyridin-1-ium-4-yl)-21,22-dihydroporphyrin.
| Compound Name | 5,10,15,20-tetrakis(1-octylpyridin-1-ium-4-yl)-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 10191876 |
| Molecular Formula | C72H94N8+4 |
| Molecular Weight | 1071.60 g/mol |
| Exact Mass | 1070.76 |
| IUPAC Name | 5,10,15,20-tetrakis(1-octylpyridin-1-ium-4-yl)-21,22-dihydroporphyrin |
| SMILES | CCCCCCCC[n+]1ccc(-c2c3nc(c(-c4cc[n+](CCCCCCCC)cc4)c4ccc([nH]4)c(-c4cc[n+](CCCCCCCC)cc4)c4ccc([nH]4)c(-c4cc[n+](CCCCCCCC)cc4)c4nc2C=C4)C=C3)cc1 |
| InChI | InChI=1S/C72H93N8/c1-5-9-13-17-21-25-45-77-49-37-57(38-50-77)69-61-29-31-63(73-61)70(58-39-51-78(52-40-58)46-26-22-18-14-10-6-2)65-33-35-67(75-65)72(60-43-55-80(56-44-60)48-28-24-20-16-12-8-4)68-36-34-66(76-68)71(64-32-30-62(69)74-64)59-41-53-79(54-42-59)47-27-23-19-15-11-7-3/h29-44,49-56H,5-28,45-48H2,1-4H3,(H,73,74,75,76)/q+3/p+1/b69-61-,69-62-,70-63-,70-65-,71-64-,71-66-,72-67-,72-68- |
| InChIKey | WYFVRWAWMJQWBN-CIILXYKUSA-O |
| XLogP | 17.92 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 80 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1071.60 |
| LogP ≤ 5 | 17.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|