C58H46N6O+2 — CID 140635987
5,10,15-triphenyl-20-[4-[[4-(1-propylpyridin-1-ium-4-yl)pyridin-1-ium-1-yl]methoxy]phenyl]-21,23-dihydroporphyrin (PubChem CID 140635987) has the molecular formula C58H46N6O+2 and a molecular weight of 843.05 g/mol. Its IUPAC name is 5,10,15-triphenyl-20-[4-[[4-(1-propylpyridin-1-ium-4-yl)pyridin-1-ium-1-yl]methoxy]phenyl]-21,23-dihydroporphyrin.
| Compound Name | 5,10,15-triphenyl-20-[4-[[4-(1-propylpyridin-1-ium-4-yl)pyridin-1-ium-1-yl]methoxy]phenyl]-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 140635987 |
| Molecular Formula | C58H46N6O+2 |
| Molecular Weight | 843.05 g/mol |
| Exact Mass | 842.37 |
| IUPAC Name | 5,10,15-triphenyl-20-[4-[[4-(1-propylpyridin-1-ium-4-yl)pyridin-1-ium-1-yl]methoxy]phenyl]-21,23-dihydroporphyrin |
| SMILES | CCC[n+]1ccc(-c2cc[n+](COc3ccc(-c4c5nc(c(-c6ccccc6)c6ccc([nH]6)c(-c6ccccc6)c6nc(c(-c7ccccc7)c7ccc4[nH]7)C=C6)C=C5)cc3)cc2)cc1 |
| InChI | InChI=1S/C58H44N6O/c1-2-34-63-35-30-40(31-36-63)41-32-37-64(38-33-41)39-65-46-20-18-45(19-21-46)58-53-28-26-51(61-53)56(43-14-8-4-9-15-43)49-24-22-47(59-49)55(42-12-6-3-7-13-42)48-23-25-50(60-48)57(44-16-10-5-11-17-44)52-27-29-54(58)62-52/h3-33,35-38H,2,34,39H2,1H3/p+2/b55-47-,55-48-,56-49-,56-51-,57-50-,57-52-,58-53-,58-54- |
| InChIKey | URVUFNGIWKIKCV-MXRZNNOWSA-P |
| XLogP | 13.01 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 843.05 |
| LogP ≤ 5 | 13.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|