C54H50N4O4 — CID 136753079
5-[4-[15-[4-(5-hydroxypentoxy)phenyl]-10,20-diphenyl-21,23-dihydroporphyrin-5-yl]phenoxy]pentan-1-ol (PubChem CID 136753079) has the molecular formula C54H50N4O4 and a molecular weight of 819.02 g/mol. Its IUPAC name is 5-[4-[15-[4-(5-hydroxypentoxy)phenyl]-10,20-diphenyl-21,23-dihydroporphyrin-5-yl]phenoxy]pentan-1-ol.
| Compound Name | 5-[4-[15-[4-(5-hydroxypentoxy)phenyl]-10,20-diphenyl-21,23-dihydroporphyrin-5-yl]phenoxy]pentan-1-ol |
|---|---|
| PubChem CID | 136753079 |
| Molecular Formula | C54H50N4O4 |
| Molecular Weight | 819.02 g/mol |
| Exact Mass | 818.38 |
| IUPAC Name | 5-[4-[15-[4-(5-hydroxypentoxy)phenyl]-10,20-diphenyl-21,23-dihydroporphyrin-5-yl]phenoxy]pentan-1-ol |
| SMILES | OCCCCCOc1ccc(-c2c3nc(c(-c4ccccc4)c4ccc([nH]4)c(-c4ccc(OCCCCCO)cc4)c4nc(c(-c5ccccc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C54H50N4O4/c59-33-9-3-11-35-61-41-21-17-39(18-22-41)53-47-29-25-43(55-47)51(37-13-5-1-6-14-37)44-26-30-48(56-44)54(40-19-23-42(24-20-40)62-36-12-4-10-34-60)50-32-28-46(58-50)52(38-15-7-2-8-16-38)45-27-31-49(53)57-45/h1-2,5-8,13-32,55,58-60H,3-4,9-12,33-36H2/b51-43-,51-44-,52-45-,52-46-,53-47-,53-49-,54-48-,54-50- |
| InChIKey | HATNVFVAIIRVKF-QRBRRFLASA-N |
| XLogP | 12.41 |
| TPSA | 116.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 819.02 |
| LogP ≤ 5 | 12.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|