C44H33N7O2 — CID 10394898
3-[4-(10,15,20-tripyridin-4-yl-21,22-dihydroporphyrin-5-yl)phenoxy]propan-1-ol (PubChem CID 10394898) has the molecular formula C44H33N7O2 and a molecular weight of 691.80 g/mol. Its IUPAC name is 3-[4-(10,15,20-tripyridin-4-yl-21,22-dihydroporphyrin-5-yl)phenoxy]propan-1-ol.
| Compound Name | 3-[4-(10,15,20-tripyridin-4-yl-21,22-dihydroporphyrin-5-yl)phenoxy]propan-1-ol |
|---|---|
| PubChem CID | 10394898 |
| Molecular Formula | C44H33N7O2 |
| Molecular Weight | 691.80 g/mol |
| Exact Mass | 691.27 |
| IUPAC Name | 3-[4-(10,15,20-tripyridin-4-yl-21,22-dihydroporphyrin-5-yl)phenoxy]propan-1-ol |
| SMILES | OCCCOc1ccc(-c2c3ccc([nH]3)c(-c3ccncc3)c3nc(c(-c4ccncc4)c4nc(c(-c5ccncc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C44H33N7O2/c52-26-1-27-53-32-4-2-28(3-5-32)41-33-6-8-35(48-33)42(29-14-20-45-21-15-29)37-10-12-39(50-37)44(31-18-24-47-25-19-31)40-13-11-38(51-40)43(30-16-22-46-23-17-30)36-9-7-34(41)49-36/h2-25,48-49,52H,1,26-27H2/b41-33-,41-34-,42-35-,42-37-,43-36-,43-38-,44-39-,44-40- |
| InChIKey | YPXFNLRGLNVVJP-LWQDQPMZSA-N |
| XLogP | 9.27 |
| TPSA | 125.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.80 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|