C100H118N12O4 — CID 101476899
5,10,15,20-tetrakis[4-(10-pyrazin-2-yldecoxy)phenyl]-21,23-dihydroporphyrin (PubChem CID 101476899) has the molecular formula C100H118N12O4 and a molecular weight of 1552.12 g/mol. Its IUPAC name is 5,10,15,20-tetrakis[4-(10-pyrazin-2-yldecoxy)phenyl]-21,23-dihydroporphyrin.
| Compound Name | 5,10,15,20-tetrakis[4-(10-pyrazin-2-yldecoxy)phenyl]-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 101476899 |
| Molecular Formula | C100H118N12O4 |
| Molecular Weight | 1552.12 g/mol |
| Exact Mass | 1550.94 |
| IUPAC Name | 5,10,15,20-tetrakis[4-(10-pyrazin-2-yldecoxy)phenyl]-21,23-dihydroporphyrin |
| SMILES | C1=Cc2nc1c(-c1ccc(OCCCCCCCCCCc3cnccn3)cc1)c1ccc([nH]1)c(-c1ccc(OCCCCCCCCCCc3cnccn3)cc1)c1nc(c(-c3ccc(OCCCCCCCCCCc4cnccn4)cc3)c3ccc([nH]3)c2-c2ccc(OCCCCCCCCCCc3cnccn3)cc2)C=C1 |
| InChI | InChI=1S/C100H118N12O4/c1(9-17-25-33-81-73-101-61-65-105-81)5-13-21-29-69-113-85-45-37-77(38-46-85)97-89-53-55-91(109-89)98(78-39-47-86(48-40-78)114-70-30-22-14-6-2-10-18-26-34-82-74-102-62-66-106-82)93-57-59-95(111-93)100(80-43-51-88(52-44-80)116-72-32-24-16-8-4-12-20-28-36-84-76-104-64-68-108-84)96-60-58-94(112-96)99(92-56-54-90(97)110-92)79-41-49-87(50-42-79)115-71-31-23-15-7-3-11-19-27-35-83-75-103-63-67-107-83/h37-68,73-76,109,112H,1-36,69-72H2/b97-89-,97-90-,98-91-,98-93-,99-92-,99-94-,100-95-,100-96- |
| InChIKey | SKTWXRPEVQKKTN-YCEIBDQGSA-N |
| XLogP | 25.45 |
| TPSA | 197.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 52 |
| Heavy Atoms | 116 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1552.12 |
| LogP ≤ 5 | 25.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|