C57H50N4OS — CID 136722601
5,10,15-tris(4-methylphenyl)-20-[4-(6-thiophen-2-ylhexoxy)phenyl]-21,23-dihydroporphyrin (PubChem CID 136722601) has the molecular formula C57H50N4OS and a molecular weight of 839.12 g/mol. Its IUPAC name is 5,10,15-tris(4-methylphenyl)-20-[4-(6-thiophen-2-ylhexoxy)phenyl]-21,23-dihydroporphyrin.
| Compound Name | 5,10,15-tris(4-methylphenyl)-20-[4-(6-thiophen-2-ylhexoxy)phenyl]-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 136722601 |
| Molecular Formula | C57H50N4OS |
| Molecular Weight | 839.12 g/mol |
| Exact Mass | 838.37 |
| IUPAC Name | 5,10,15-tris(4-methylphenyl)-20-[4-(6-thiophen-2-ylhexoxy)phenyl]-21,23-dihydroporphyrin |
| SMILES | Cc1ccc(-c2c3nc(c(-c4ccc(C)cc4)c4ccc([nH]4)c(-c4ccc(OCCCCCCc5cccs5)cc4)c4nc(c(-c5ccc(C)cc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C57H50N4OS/c1-37-11-17-40(18-12-37)54-46-27-29-48(58-46)55(41-19-13-38(2)14-20-41)50-31-33-52(60-50)57(43-23-25-44(26-24-43)62-35-7-5-4-6-9-45-10-8-36-63-45)53-34-32-51(61-53)56(49-30-28-47(54)59-49)42-21-15-39(3)16-22-42/h8,10-34,36,58,61H,4-7,9,35H2,1-3H3/b54-46-,54-47-,55-48-,55-50-,56-49-,56-51-,57-52-,57-53- |
| InChIKey | UYNIIVARFWZZGD-RXISYZRNSA-N |
| XLogP | 15.49 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 839.12 |
| LogP ≤ 5 | 15.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|