C49H41IN6O4 — CID 137274124
5-(4-iodophenyl)-15-[4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenyl]-10,20-dipyridin-4-yl-21,23-dihydroporphyrin (PubChem CID 137274124) has the molecular formula C49H41IN6O4 and a molecular weight of 904.81 g/mol. Its IUPAC name is 5-(4-iodophenyl)-15-[4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenyl]-10,20-dipyridin-4-yl-21,23-dihydroporphyrin.
| Compound Name | 5-(4-iodophenyl)-15-[4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenyl]-10,20-dipyridin-4-yl-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 137274124 |
| Molecular Formula | C49H41IN6O4 |
| Molecular Weight | 904.81 g/mol |
| Exact Mass | 904.22 |
| IUPAC Name | 5-(4-iodophenyl)-15-[4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenyl]-10,20-dipyridin-4-yl-21,23-dihydroporphyrin |
| SMILES | COCCOCCOCCOc1ccc(-c2c3nc(c(-c4ccncc4)c4ccc([nH]4)c(-c4ccc(I)cc4)c4nc(c(-c5ccncc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C49H41IN6O4/c1-57-26-27-58-28-29-59-30-31-60-37-8-4-33(5-9-37)47-40-12-16-44(55-40)48(34-18-22-51-23-19-34)42-14-10-38(53-42)46(32-2-6-36(50)7-3-32)39-11-15-43(54-39)49(35-20-24-52-25-21-35)45-17-13-41(47)56-45/h2-25,53,56H,26-31H2,1H3/b46-38-,46-39-,47-40-,47-41-,48-42-,48-44-,49-43-,49-45- |
| InChIKey | FBDSKUGJMRDBPH-HTVDRVQMSA-N |
| XLogP | 10.78 |
| TPSA | 120.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 904.81 |
| LogP ≤ 5 | 10.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|