C19H34N2O2 — CID 166688598
4,6-dimethoxy-5-[(6R)-tridecan-6-yl]pyrimidine (PubChem CID 166688598) has the molecular formula C19H34N2O2 and a molecular weight of 322.49 g/mol. Its IUPAC name is 4,6-dimethoxy-5-[(6R)-tridecan-6-yl]pyrimidine.
| Compound Name | 4,6-dimethoxy-5-[(6R)-tridecan-6-yl]pyrimidine |
|---|---|
| PubChem CID | 166688598 |
| Molecular Formula | C19H34N2O2 |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.26 |
| IUPAC Name | 4,6-dimethoxy-5-[(6R)-tridecan-6-yl]pyrimidine |
| SMILES | CCCCCCC[C@@H](CCCCC)c1c(OC)ncnc1OC |
| InChI | InChI=1S/C19H34N2O2/c1-5-7-9-10-12-14-16(13-11-8-6-2)17-18(22-3)20-15-21-19(17)23-4/h15-16H,5-14H2,1-4H3/t16-/m1/s1 |
| InChIKey | KMPAPBRDSFTNJE-MRXNPFEDSA-N |
| XLogP | 5.52 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|