C42H34N4Zn — CID 164677599
zinc 5-ethenyl-15-oct-1-ynyl-10,20-diphenylporphyrin-22,24-diide (PubChem CID 164677599) has the molecular formula C42H34N4Zn and a molecular weight of 660.15 g/mol. Its IUPAC name is zinc 5-ethenyl-15-oct-1-ynyl-10,20-diphenylporphyrin-22,24-diide.
| Compound Name | zinc 5-ethenyl-15-oct-1-ynyl-10,20-diphenylporphyrin-22,24-diide |
|---|---|
| PubChem CID | 164677599 |
| Molecular Formula | C42H34N4Zn |
| Molecular Weight | 660.15 g/mol |
| Exact Mass | 658.21 |
| IUPAC Name | zinc 5-ethenyl-15-oct-1-ynyl-10,20-diphenylporphyrin-22,24-diide |
| SMILES | C=Cc1c2nc(c(-c3ccccc3)c3ccc([n-]3)c(C#CCCCCCC)c3nc(c(-c4ccccc4)c4ccc1[n-]4)C=C3)C=C2.[Zn+2] |
| InChI | InChI=1S/C42H34N4.Zn/c1-3-5-6-7-8-15-20-32-35-23-27-39(45-35)41(29-16-11-9-12-17-29)37-25-21-33(43-37)31(4-2)34-22-26-38(44-34)42(30-18-13-10-14-19-30)40-28-24-36(32)46-40;/h4,9-14,16-19,21-28H,2-3,5-8H2,1H3;/q-2;+2/b33-31-,34-31-,35-32-,36-32-,41-37-,41-39-,42-38-,42-40-; |
| InChIKey | ZMYMUUOKKKABGF-BNNLMONQSA-N |
| XLogP | 10.21 |
| TPSA | 53.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.15 |
| LogP ≤ 5 | 10.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|