C46H30N4Zn — CID 24949359
zinc 2-ethenyl-5,10,15,20-tetraphenylporphyrin-21,23-diide (PubChem CID 24949359) has the molecular formula C46H30N4Zn and a molecular weight of 704.16 g/mol. Its IUPAC name is zinc 2-ethenyl-5,10,15,20-tetraphenylporphyrin-21,23-diide.
| Compound Name | zinc 2-ethenyl-5,10,15,20-tetraphenylporphyrin-21,23-diide |
|---|---|
| PubChem CID | 24949359 |
| Molecular Formula | C46H30N4Zn |
| Molecular Weight | 704.16 g/mol |
| Exact Mass | 702.18 |
| IUPAC Name | zinc 2-ethenyl-5,10,15,20-tetraphenylporphyrin-21,23-diide |
| SMILES | C=Cc1cc2[n-]c1c(-c1ccccc1)c1nc(c(-c3ccccc3)c3ccc([n-]3)c(-c3ccccc3)c3nc(c2-c2ccccc2)C=C3)C=C1.[Zn+2] |
| InChI | InChI=1S/C46H30N4.Zn/c1-2-30-29-41-44(33-19-11-5-12-20-33)39-26-25-37(48-39)42(31-15-7-3-8-16-31)35-23-24-36(47-35)43(32-17-9-4-10-18-32)38-27-28-40(49-38)45(46(30)50-41)34-21-13-6-14-22-34;/h2-29H,1H2;/q-2;+2/b42-35-,42-37-,43-36-,43-38-,44-39-,44-41-,45-40-,46-45-; |
| InChIKey | OJCGKJITAHQPQO-WNTUHYLGSA-N |
| XLogP | 11.22 |
| TPSA | 53.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.16 |
| LogP ≤ 5 | 11.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|