C50H31N5O2Zn — CID 59844022
zinc (2Z,4E)-2-isocyano-5-(5,10,15,20-tetraphenylporphyrin-21,23-diid-2-yl)penta-2,4-dienoic acid (PubChem CID 59844022) has the molecular formula C50H31N5O2Zn and a molecular weight of 799.22 g/mol. Its IUPAC name is zinc (2Z,4E)-2-isocyano-5-(5,10,15,20-tetraphenylporphyrin-21,23-diid-2-yl)penta-2,4-dienoic acid.
| Compound Name | zinc (2Z,4E)-2-isocyano-5-(5,10,15,20-tetraphenylporphyrin-21,23-diid-2-yl)penta-2,4-dienoic acid |
|---|---|
| PubChem CID | 59844022 |
| Molecular Formula | C50H31N5O2Zn |
| Molecular Weight | 799.22 g/mol |
| Exact Mass | 797.18 |
| IUPAC Name | zinc (2Z,4E)-2-isocyano-5-(5,10,15,20-tetraphenylporphyrin-21,23-diid-2-yl)penta-2,4-dienoic acid |
| SMILES | [C-]#[N+]/C(=C\C=C\c1cc2[n-]c1c(-c1ccccc1)c1nc(c(-c3ccccc3)c3ccc([n-]3)c(-c3ccccc3)c3nc(c2-c2ccccc2)C=C3)C=C1)C(=O)O.[Zn+2] |
| InChI | InChI=1S/C50H32N5O2.Zn/c1-51-43(50(56)57)24-14-23-36-31-44-47(34-19-10-4-11-20-34)41-28-27-39(53-41)45(32-15-6-2-7-16-32)37-25-26-38(52-37)46(33-17-8-3-9-18-33)40-29-30-42(54-40)48(49(36)55-44)35-21-12-5-13-22-35;/h2-31H,(H2-,52,53,54,55,56,57);/q-1;+2/p-1/b23-14+,43-24-,45-37-,45-39-,46-38-,46-40-,47-41-,47-44-,48-42-,49-48-; |
| InChIKey | CAWXABLQGHCFFL-QFJZHKQESA-M |
| XLogP | 11.48 |
| TPSA | 95.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 799.22 |
| LogP ≤ 5 | 11.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|