C52H74N4Si2 — CID 162097360
2-[10,20-dipentyl-15-[2-tri(propan-2-yl)silylethynyl]-21,22-dihydroporphyrin-5-yl]ethynyl-tri(propan-2-yl)silane (PubChem CID 162097360) has the molecular formula C52H74N4Si2 and a molecular weight of 811.36 g/mol. Its IUPAC name is 2-[10,20-dipentyl-15-[2-tri(propan-2-yl)silylethynyl]-21,22-dihydroporphyrin-5-yl]ethynyl-tri(propan-2-yl)silane.
| Compound Name | 2-[10,20-dipentyl-15-[2-tri(propan-2-yl)silylethynyl]-21,22-dihydroporphyrin-5-yl]ethynyl-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 162097360 |
| Molecular Formula | C52H74N4Si2 |
| Molecular Weight | 811.36 g/mol |
| Exact Mass | 810.55 |
| IUPAC Name | 2-[10,20-dipentyl-15-[2-tri(propan-2-yl)silylethynyl]-21,22-dihydroporphyrin-5-yl]ethynyl-tri(propan-2-yl)silane |
| SMILES | CCCCCc1c2nc(c(C#C[Si](C(C)C)(C(C)C)C(C)C)c3nc(c(CCCCC)c4ccc([nH]4)c(C#C[Si](C(C)C)(C(C)C)C(C)C)c4ccc1[nH]4)C=C3)C=C2 |
| InChI | InChI=1S/C52H74N4Si2/c1-15-17-19-21-41-45-23-27-49(53-45)43(31-33-57(35(3)4,36(5)6)37(7)8)51-29-25-47(55-51)42(22-20-18-16-2)48-26-30-52(56-48)44(50-28-24-46(41)54-50)32-34-58(38(9)10,39(11)12)40(13)14/h23-30,35-40,53,55H,15-22H2,1-14H3/b45-41-,46-41-,47-42-,48-42-,49-43-,50-44-,51-43-,52-44- |
| InChIKey | GZXFPSCNKWZASR-INXFQSGYSA-N |
| XLogP | 15.26 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 811.36 |
| LogP ≤ 5 | 15.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|