C32H40N4Si — CID 71518795
(10,20-dibutyl-23,24-dihydroporphyrin-5-yl)methyl-trimethylsilane (PubChem CID 71518795) has the molecular formula C32H40N4Si and a molecular weight of 508.79 g/mol. Its IUPAC name is (10,20-dibutyl-23,24-dihydroporphyrin-5-yl)methyl-trimethylsilane.
| Compound Name | (10,20-dibutyl-23,24-dihydroporphyrin-5-yl)methyl-trimethylsilane |
|---|---|
| PubChem CID | 71518795 |
| Molecular Formula | C32H40N4Si |
| Molecular Weight | 508.79 g/mol |
| Exact Mass | 508.30 |
| IUPAC Name | (10,20-dibutyl-23,24-dihydroporphyrin-5-yl)methyl-trimethylsilane |
| SMILES | CCCCc1c2nc(c(C[Si](C)(C)C)c3nc(c(CCCC)c4ccc(cc5ccc1[nH]5)[nH]4)C=C3)C=C2 |
| InChI | InChI=1S/C32H40N4Si/c1-6-8-10-24-27-14-12-22(33-27)20-23-13-15-28(34-23)25(11-9-7-2)30-17-19-32(36-30)26(21-37(3,4)5)31-18-16-29(24)35-31/h12-20,33-34H,6-11,21H2,1-5H3/b22-20-,23-20-,27-24-,28-25-,29-24-,30-25-,31-26-,32-26- |
| InChIKey | ICRISDYORLAKRF-JCQUMXAHSA-N |
| XLogP | 8.76 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.79 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|