C28H30N4 — CID 46184275
15-butyl-5-tert-butyl-21,22-dihydroporphyrin (PubChem CID 46184275) has the molecular formula C28H30N4 and a molecular weight of 422.58 g/mol. Its IUPAC name is 15-butyl-5-tert-butyl-21,22-dihydroporphyrin.
| Compound Name | 15-butyl-5-tert-butyl-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 46184275 |
| Molecular Formula | C28H30N4 |
| Molecular Weight | 422.58 g/mol |
| Exact Mass | 422.25 |
| IUPAC Name | 15-butyl-5-tert-butyl-21,22-dihydroporphyrin |
| SMILES | CCCCc1c2nc(cc3ccc([nH]3)c(C(C)(C)C)c3ccc(cc4nc1C=C4)[nH]3)C=C2 |
| InChI | InChI=1S/C28H30N4/c1-5-6-7-22-23-12-8-18(29-23)16-20-10-14-25(31-20)27(28(2,3)4)26-15-11-21(32-26)17-19-9-13-24(22)30-19/h8-17,31-32H,5-7H2,1-4H3/b18-16-,19-17-,20-16-,21-17-,23-22-,24-22-,27-25+,27-26+ |
| InChIKey | UFNPLTTWHRAAIY-GLXOKZGISA-N |
| XLogP | 7.30 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.58 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |