C34H34N4O2 — CID 86056630
5-(3,5-dimethoxyphenyl)-15-hexyl-21,22-dihydroporphyrin (PubChem CID 86056630) has the molecular formula C34H34N4O2 and a molecular weight of 530.67 g/mol. Its IUPAC name is 5-(3,5-dimethoxyphenyl)-15-hexyl-21,22-dihydroporphyrin.
| Compound Name | 5-(3,5-dimethoxyphenyl)-15-hexyl-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 86056630 |
| Molecular Formula | C34H34N4O2 |
| Molecular Weight | 530.67 g/mol |
| Exact Mass | 530.27 |
| IUPAC Name | 5-(3,5-dimethoxyphenyl)-15-hexyl-21,22-dihydroporphyrin |
| SMILES | CCCCCCc1c2nc(cc3ccc([nH]3)c(-c3cc(OC)cc(OC)c3)c3ccc(cc4nc1C=C4)[nH]3)C=C2 |
| InChI | InChI=1S/C34H34N4O2/c1-4-5-6-7-8-29-30-13-9-23(35-30)19-25-11-15-32(37-25)34(22-17-27(39-2)21-28(18-22)40-3)33-16-12-26(38-33)20-24-10-14-31(29)36-24/h9-21,37-38H,4-8H2,1-3H3/b23-19-,24-20-,25-19-,26-20-,30-29-,31-29-,34-32-,34-33- |
| InChIKey | UIJNXXXDWYNBBP-VDDRQSRTSA-N |
| XLogP | 8.46 |
| TPSA | 75.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.67 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|