C64H74N8 — CID 135448344
8-(10,20-dihexyl-21,23-dihydroporphyrin-5-yl)-5,15-dihexyl-21,23-dihydroporphyrin (PubChem CID 135448344) has the molecular formula C64H74N8 and a molecular weight of 955.35 g/mol. Its IUPAC name is 8-(10,20-dihexyl-21,23-dihydroporphyrin-5-yl)-5,15-dihexyl-21,23-dihydroporphyrin.
| Compound Name | 8-(10,20-dihexyl-21,23-dihydroporphyrin-5-yl)-5,15-dihexyl-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 135448344 |
| Molecular Formula | C64H74N8 |
| Molecular Weight | 955.35 g/mol |
| Exact Mass | 954.60 |
| IUPAC Name | 8-(10,20-dihexyl-21,23-dihydroporphyrin-5-yl)-5,15-dihexyl-21,23-dihydroporphyrin |
| SMILES | CCCCCCc1c2nc(cc3ccc([nH]3)c(CCCCCC)c3nc(cc4ccc1[nH]4)C(c1c4nc(c(CCCCCC)c5ccc(cc6nc(c(CCCCCC)c7ccc1[nH]7)C=C6)[nH]5)C=C4)=C3)C=C2 |
| InChI | InChI=1S/C64H74N8/c1-5-9-13-17-21-48-53-30-25-43(65-53)40-46-28-33-57(68-46)51(24-20-16-12-8-4)63-42-52(62(72-63)41-47-29-34-54(48)69-47)64-60-37-35-58(70-60)49(22-18-14-10-6-2)55-31-26-44(66-55)39-45-27-32-56(67-45)50(23-19-15-11-7-3)59-36-38-61(64)71-59/h25-42,66,68-69,71H,5-24H2,1-4H3/b43-40-,44-39-,45-39-,46-40-,47-41-,53-48-,54-48-,55-49-,56-50-,57-51-,58-49-,59-50-,62-41-,63-51-,64-60-,64-61- |
| InChIKey | YDLHWLLFRYZQPC-OFOQLTFFSA-N |
| XLogP | 17.53 |
| TPSA | 114.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 955.35 |
| LogP ≤ 5 | 17.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|