C25H23BrN4 — CID 163539540
10-(5-bromopentyl)-21,22-dihydroporphyrin (PubChem CID 163539540) has the molecular formula C25H23BrN4 and a molecular weight of 459.39 g/mol. Its IUPAC name is 10-(5-bromopentyl)-21,22-dihydroporphyrin.
| Compound Name | 10-(5-bromopentyl)-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 163539540 |
| Molecular Formula | C25H23BrN4 |
| Molecular Weight | 459.39 g/mol |
| Exact Mass | 458.11 |
| IUPAC Name | 10-(5-bromopentyl)-21,22-dihydroporphyrin |
| SMILES | BrCCCCCc1c2nc(cc3nc(cc4ccc(cc5ccc1[nH]5)[nH]4)C=C3)C=C2 |
| InChI | InChI=1S/C25H23BrN4/c26-13-3-1-2-4-23-24-11-9-21(29-24)15-19-7-5-17(27-19)14-18-6-8-20(28-18)16-22-10-12-25(23)30-22/h5-12,14-16,27,29H,1-4,13H2/b17-14-,18-14-,19-15-,20-16-,21-15-,22-16-,24-23-,25-23- |
| InChIKey | RFRBTMSFAHZRBZ-NSCOLUPZSA-N |
| XLogP | 6.76 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.39 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|