C23H16N4O — CID 136825706
(15-ethynyl-21,22-dihydroporphyrin-5-yl)methanol (PubChem CID 136825706) has the molecular formula C23H16N4O and a molecular weight of 364.41 g/mol. Its IUPAC name is (15-ethynyl-21,22-dihydroporphyrin-5-yl)methanol.
| Compound Name | (15-ethynyl-21,22-dihydroporphyrin-5-yl)methanol |
|---|---|
| PubChem CID | 136825706 |
| Molecular Formula | C23H16N4O |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | (15-ethynyl-21,22-dihydroporphyrin-5-yl)methanol |
| SMILES | C#Cc1c2nc(cc3ccc([nH]3)c(CO)c3ccc(cc4nc1C=C4)[nH]3)C=C2 |
| InChI | InChI=1S/C23H16N4O/c1-2-18-20-7-3-14(24-20)11-16-5-9-22(26-16)19(13-28)23-10-6-17(27-23)12-15-4-8-21(18)25-15/h1,3-12,26-28H,13H2/b14-11-,15-12-,16-11-,17-12-,20-18-,21-18-,22-19-,23-19- |
| InChIKey | GBYZXFQRBATDEV-IREMWXBBSA-N |
| XLogP | 4.13 |
| TPSA | 77.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|