C22H20CoN4O — CID 174944613
cobalt;21,22-dihydroporphyrin;ethanol (PubChem CID 174944613) has the molecular formula C22H20CoN4O and a molecular weight of 415.36 g/mol. Its IUPAC name is cobalt;21,22-dihydroporphyrin;ethanol.
| Compound Name | cobalt;21,22-dihydroporphyrin;ethanol |
|---|---|
| PubChem CID | 174944613 |
| Molecular Formula | C22H20CoN4O |
| Molecular Weight | 415.36 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | cobalt;21,22-dihydroporphyrin;ethanol |
| SMILES | C1=Cc2cc3ccc(cc4ccc(cc5nc(cc1n2)C=C5)[nH]4)[nH]3.CCO.[Co] |
| InChI | InChI=1S/C20H14N4.C2H6O.Co/c1-2-14-10-16-5-6-18(23-16)12-20-8-7-19(24-20)11-17-4-3-15(22-17)9-13(1)21-14;1-2-3;/h1-12,21-22H;3H,2H2,1H3;/b13-9-,14-10-,15-9-,16-10-,17-11-,18-12-,19-11-,20-12-;; |
| InChIKey | FYLXHQPZYSIRRF-IAULSPAKSA-N |
| XLogP | 4.65 |
| TPSA | 77.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.36 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |