C42H42N4O3 — CID 135863103
10-hexyl-15-(4-methylphenyl)-5-(2,4,6-trimethoxyphenyl)-21,23-dihydroporphyrin (PubChem CID 135863103) has the molecular formula C42H42N4O3 and a molecular weight of 650.82 g/mol. Its IUPAC name is 10-hexyl-15-(4-methylphenyl)-5-(2,4,6-trimethoxyphenyl)-21,23-dihydroporphyrin.
| Compound Name | 10-hexyl-15-(4-methylphenyl)-5-(2,4,6-trimethoxyphenyl)-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 135863103 |
| Molecular Formula | C42H42N4O3 |
| Molecular Weight | 650.82 g/mol |
| Exact Mass | 650.33 |
| IUPAC Name | 10-hexyl-15-(4-methylphenyl)-5-(2,4,6-trimethoxyphenyl)-21,23-dihydroporphyrin |
| SMILES | CCCCCCc1c2nc(c(-c3c(OC)cc(OC)cc3OC)c3ccc(cc4nc(c(-c5ccc(C)cc5)c5ccc1[nH]5)C=C4)[nH]3)C=C2 |
| InChI | InChI=1S/C42H42N4O3/c1-6-7-8-9-10-31-32-19-21-35(45-32)40(27-13-11-26(2)12-14-27)34-17-15-28(43-34)23-29-16-18-36(44-29)41(37-22-20-33(31)46-37)42-38(48-4)24-30(47-3)25-39(42)49-5/h11-25,44-45H,6-10H2,1-5H3/b28-23-,29-23-,32-31-,33-31-,40-34-,40-35-,41-36+,41-37+ |
| InChIKey | QEERYAWSNGRTBM-YFOSYWFDSA-N |
| XLogP | 10.45 |
| TPSA | 85.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.82 |
| LogP ≤ 5 | 10.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|