C67H75N5S — CID 161273736
10-butyl-3-[2-[10,20-didecyl-15-[2-(4-methylphenyl)ethynyl]-21,22-dihydroporphyrin-5-yl]ethynyl]phenothiazine (PubChem CID 161273736) has the molecular formula C67H75N5S and a molecular weight of 982.44 g/mol. Its IUPAC name is 10-butyl-3-[2-[10,20-didecyl-15-[2-(4-methylphenyl)ethynyl]-21,22-dihydroporphyrin-5-yl]ethynyl]phenothiazine.
| Compound Name | 10-butyl-3-[2-[10,20-didecyl-15-[2-(4-methylphenyl)ethynyl]-21,22-dihydroporphyrin-5-yl]ethynyl]phenothiazine |
|---|---|
| PubChem CID | 161273736 |
| Molecular Formula | C67H75N5S |
| Molecular Weight | 982.44 g/mol |
| Exact Mass | 981.57 |
| IUPAC Name | 10-butyl-3-[2-[10,20-didecyl-15-[2-(4-methylphenyl)ethynyl]-21,22-dihydroporphyrin-5-yl]ethynyl]phenothiazine |
| SMILES | CCCCCCCCCCc1c2nc(c(C#Cc3ccc(C)cc3)c3nc(c(CCCCCCCCCC)c4ccc([nH]4)c(C#Cc4ccc5c(c4)Sc4ccccc4N5CCCC)c4ccc1[nH]4)C=C3)C=C2 |
| InChI | InChI=1S/C67H75N5S/c1-5-8-11-13-15-17-19-21-25-52-56-38-42-60(68-56)54(36-33-50-31-29-49(4)30-32-50)61-43-39-57(69-61)53(26-22-20-18-16-14-12-9-6-2)59-41-45-63(71-59)55(62-44-40-58(52)70-62)37-34-51-35-46-65-67(48-51)73-66-28-24-23-27-64(66)72(65)47-10-7-3/h23-24,27-32,35,38-46,48,70-71H,5-22,25-26,47H2,1-4H3/b56-52-,57-53-,58-52-,59-53-,60-54-,61-54-,62-55-,63-55- |
| InChIKey | NGLDCPJKKLKYFO-HLBIEZTRSA-N |
| XLogP | 18.53 |
| TPSA | 60.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 982.44 |
| LogP ≤ 5 | 18.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|