C46H46N4O8P2Zn — CID 56654860
zinc 5,15-bis[(E)-2-diethoxyphosphorylethenyl]-10,20-bis(3-methoxyphenyl)porphyrin-22,24-diide (PubChem CID 56654860) has the molecular formula C46H46N4O8P2Zn and a molecular weight of 910.23 g/mol. Its IUPAC name is zinc 5,15-bis[(E)-2-diethoxyphosphorylethenyl]-10,20-bis(3-methoxyphenyl)porphyrin-22,24-diide.
| Compound Name | zinc 5,15-bis[(E)-2-diethoxyphosphorylethenyl]-10,20-bis(3-methoxyphenyl)porphyrin-22,24-diide |
|---|---|
| PubChem CID | 56654860 |
| Molecular Formula | C46H46N4O8P2Zn |
| Molecular Weight | 910.23 g/mol |
| Exact Mass | 908.21 |
| IUPAC Name | zinc 5,15-bis[(E)-2-diethoxyphosphorylethenyl]-10,20-bis(3-methoxyphenyl)porphyrin-22,24-diide |
| SMILES | CCOP(=O)(/C=C/c1c2nc(c(-c3cccc(OC)c3)c3ccc([n-]3)c(/C=C/P(=O)(OCC)OCC)c3nc(c(-c4cccc(OC)c4)c4ccc1[n-]4)C=C3)C=C2)OCC.[Zn+2] |
| InChI | InChI=1S/C46H46N4O8P2.Zn/c1-7-55-59(51,56-8-2)27-25-35-37-17-21-41(47-37)45(31-13-11-15-33(29-31)53-5)43-23-19-39(49-43)36(26-28-60(52,57-9-3)58-10-4)40-20-24-44(50-40)46(42-22-18-38(35)48-42)32-14-12-16-34(30-32)54-6;/h11-30H,7-10H2,1-6H3;/q-2;+2/b27-25+,28-26+,37-35-,38-35-,39-36-,40-36-,45-41-,45-43-,46-42-,46-44-; |
| InChIKey | YFXUOEHYVLRDFJ-VMKZSVTISA-N |
| XLogP | 11.74 |
| TPSA | 143.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 910.23 |
| LogP ≤ 5 | 11.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|