C52H30N4O2Zn — CID 11083327
zinc 3-(10,15,20-triphenylporphyrin-22,24-diid-5-yl)phenanthrene-9,10-dione (PubChem CID 11083327) has the molecular formula C52H30N4O2Zn and a molecular weight of 808.23 g/mol. Its IUPAC name is zinc 3-(10,15,20-triphenylporphyrin-22,24-diid-5-yl)phenanthrene-9,10-dione.
| Compound Name | zinc 3-(10,15,20-triphenylporphyrin-22,24-diid-5-yl)phenanthrene-9,10-dione |
|---|---|
| PubChem CID | 11083327 |
| Molecular Formula | C52H30N4O2Zn |
| Molecular Weight | 808.23 g/mol |
| Exact Mass | 806.17 |
| IUPAC Name | zinc 3-(10,15,20-triphenylporphyrin-22,24-diid-5-yl)phenanthrene-9,10-dione |
| SMILES | O=C1C(=O)c2ccc(-c3c4nc(c(-c5ccccc5)c5ccc([n-]5)c(-c5ccccc5)c5nc(c(-c6ccccc6)c6ccc3[n-]6)C=C5)C=C4)cc2-c2ccccc21.[Zn+2] |
| InChI | InChI=1S/C52H32N4O2.Zn/c57-51-36-19-11-10-18-35(36)38-30-34(20-21-37(38)52(51)58)50-45-28-26-43(55-45)48(32-14-6-2-7-15-32)41-24-22-39(53-41)47(31-12-4-1-5-13-31)40-23-25-42(54-40)49(33-16-8-3-9-17-33)44-27-29-46(50)56-44;/h1-30H,(H2,53,54,55,56,57,58);/q;+2/p-2/b47-39-,47-40-,48-41-,48-43-,49-42-,49-44-,50-45-,50-46-; |
| InChIKey | VFHPRVRQGFPHNX-RYKZPZDGSA-L |
| XLogP | 11.63 |
| TPSA | 88.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.23 |
| LogP ≤ 5 | 11.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|